| Name |
Benzyl benzoate |
| Formula |
C14H12O2 |
| Mw |
212.08372963 |
| CAS RN |
120-51-4 |
| C_ID |
C00019221
, 
|
| InChIKey |
SESFRYSPDFLNCH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| SMILES |
O=C(OCc1ccccc1)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus L.  | Ref. |
| Plantae | Caryophyllaceae | Silene latifolia  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Cruciferae | Hesperis matronalis  | Ref. |
| Plantae | Fabaceae | Tephrosia toxicaria | Ref. |
| Plantae | Lauraceae | Cinnamomum zeylanicum  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum multiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum spp | Ref. |
| Plantae | Oleaceae | Jasminum spp.  | Ref. |
| Plantae | Phytolaccaceae | Petiveria alliacea  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana alata | Ref. |
| Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
| Plantae | Solanaceae | Nicotiana cavicola  | Ref. |
| Plantae | Solanaceae | Nicotiana langsdorffii | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|