| Name |
Hopeaphenol (-)-Hopeaphenol |
| Formula |
C56H42O12 |
| Mw |
906.26762681 |
| CAS RN |
17912-85-5 |
| C_ID |
C00015786
, 
|
| InChIKey |
YQQUILZPDYJDQJ-IKPWFECENA-N |
| InChICode |
InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51+,52+,53-,54-,55+,56+/m1/s1 |
| SMILES |
Oc1ccc([C@@H]2c3c(O)cc(O)cc3[C@@H]3c4c(cc(O)cc4[C@H]2[C@@H]2c4cc(O)cc5c4[C@@H](c4cc(O)cc(O)c4[C@H]2c2ccc(O)cc2)[C@H](c2ccc(O)cc2)O5)O[C@H]3c2ccc(O)cc2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dipterocarpaceae | Balanocarpus heimii | Ref. |
| Plantae | Dipterocarpaceae | Hopea odorata  | Ref. |
| Plantae | Dipterocarpaceae | Hopea parviflora | Ref. |
| Plantae | Dipterocarpaceae | Shorea hemsleyana | Ref. |
| Plantae | Dipterocarpaceae | Shorea robusta  | Ref. |
| Plantae | Dipterocarpaceae | Shorea talura | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis berlandieri | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis chunganensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis davidii | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis pentagona | Ref. |
| Plantae | Vitaceae | Vitis riparia  | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Muscadinia rotundifolia | Ref. |
|
|
zoom in
| Organism | Vitis pentagona | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|