| Name |
Ajugol Leonuride |
| Formula |
C15H24O9 |
| Mw |
348.14203237 |
| CAS RN |
52949-83-4 |
| C_ID |
C00010600
, 
|
| InChIKey |
VELYAQRXBJLJAK-DDXUWRRDNA-N |
| InChICode |
InChI=1S/C15H24O9/c1-15(21)4-7(17)6-2-3-22-13(9(6)15)24-14-12(20)11(19)10(18)8(5-16)23-14/h2-3,6-14,16-21H,4-5H2,1H3/t6-,7-,8-,9-,10-,11+,12+,13+,14-,15+/m1/s1 |
| SMILES |
C[C@]1(O)C[C@@H](O)[C@@H]2C=CO[C@@H](O[C@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia gangetica L.  | Ref. |
| Plantae | Acanthaceae | Asystasia intrusa | Ref. |
| Plantae | Bignoniaceae | Kigelia pinnata DC.  | Ref. |
| Plantae | Bignoniaceae | Markhamia stipulata  | Ref. |
| Plantae | Bignoniaceae | Stereospermum cylindricum  | Ref. |
| Plantae | Celastraceae | Maytenus loevis | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Leonurus cardiaca  | Ref. |
| Plantae | Labiatae | Melittis melissophyllum  | Ref. |
| Plantae | Orobanchaceae | Cistanche tubulosa  | Ref. |
| Plantae | Plantaginaceae | Veronicastrum sibiricum (L.) Pennell | Ref. |
| Plantae | Plantaginaceae | Veronicastrum virginicum (L.) Farw.  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Triaenophora rupestris | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|