| Name |
(-)-Epicatechin 3-O-gallate (-)-Epicatechin gallate |
| Formula |
C22H18O10 |
| Mw |
442.0899968 |
| CAS RN |
1257-08-5 |
| C_ID |
C00008866
, 
|
| InChIKey |
LSHVYAFMTMFKBA-VCZXBEBONA-N |
| InChICode |
InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21-/m1/s1 |
| SMILES |
O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cistaceae | Cistus salviifolius | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Crassulaceae | Sedum sediforme  | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Fabaceae | Acacia pycnantha | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Hamamelidaceae | Hamamelis virginiana  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L.  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
| Plantae | Polygonaceae | Rheum sp. | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Polygonaceae | Rumex thyrsiflorus  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Ampelopsis japonica | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Rheum sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Bradfield,J.Chem.Soc.,(1948),2249
Weinges,Ann.,748,(1971),218 |
|---|
|