| Name |
alpha-Tocopherol |
| Formula |
C29H50O2 |
| Mw |
430.38108084 |
| CAS RN |
59-02-9 |
| C_ID |
C00007366
, 
|
| InChIKey |
GVJHHUAWPYXKBD-BFRPKOEANA-N |
| InChICode |
InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
| SMILES |
Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Amaranthus hypochondriacus L.  | Ref. |
| Plantae | Annonaceae | Uvaria pandensis | Ref. |
| Plantae | Apiaceae | Carum carvi L.  | Ref. |
| Plantae | Apiaceae | Coriandrum sativum L.  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare L.  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Bixaceae | Bixa orellana L.  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum L.  | Ref. |
| Plantae | Caryophyllaceae | Lychnis coronaria  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Dictyosphaeriaceae | Botryococcus braunii | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Ericaceae | Vaccinium macrocarpon Aiton  | Ref. |
| Plantae | Euphorbiaceae | Hevea brasiliensis Mull.Arg.  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Juglandaceae | Juglans regia L.  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis L.  | Ref. |
| Plantae | Lauraceae | Machilus zuihoensis | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
| Plantae | Meliaceae | Xylocarpus granatum  | Ref. |
| Plantae | Myrtaceae | Feijoa sellowiana  | Ref. |
| Plantae | Palmae | Cocos nucifera L.  | Ref. |
| Plantae | Palmae | Elaeis guineensis Jacq.  | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Poaceae | Avena sativa L.  | Ref. |
| Plantae | Poaceae | Hordeum vulgare L.  | Ref. |
| Plantae | Poaceae | Oryza sativa L.  | Ref. |
| Plantae | Poaceae | Secale cereale L.  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Proteaceae | Gevuina avellana Mol. | Ref. |
| Plantae | Ranunculaceae | Delphinium ajacis L. | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum Hort.  | Ref. |
| Plantae | Sapindaceae | Litchi chinensis Sonn.  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum L.  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Vitaceae | Vitis vinifera L.  | Ref. |
|
|
zoom in
| Organism | Terminalia brasiliensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|