| Name |
4'-Methylcapillarisin Pectolinarigenin |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
520-12-7 |
| C_ID |
C00003838
, 
|
| InChIKey |
GPQLHGCIAUEJQK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)13-7-11(18)15-14(23-13)8-12(19)17(22-2)16(15)20/h3-8,19-20H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia camphorata | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Artemisia vestita  | Ref. |
| Plantae | Asteraceae | Iva frutescens | Ref. |
| Plantae | Fabaceae | Cassia renigera | Ref. |
| Plantae | Labiatae | Clerodendrum phlomidis  | Ref. |
| Plantae | Labiatae | Mentha pulegium  | Ref. |
| Plantae | Labiatae | Salvia hypoleuca | Ref. |
| Plantae | Labiatae | Salvia pedicellata | Ref. |
| Plantae | Labiatae | Salvia yosgadensis | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi  | Ref. |
| Plantae | Plantaginaceae | Digitalis schischkinii | Ref. |
| Plantae | Plantaginaceae | Linaria japonicum | Ref. |
| Plantae | Plantaginaceae | Linaria vulgaris  | Ref. |
| Plantae | Verbenaceae | Clerodendron inerme  | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
| Plantae | Verbenaceae | Duranta repens | Ref. |
| Plantae | Zosteraceae | Phyllospadix japonicus | Ref. |
|
|
zoom in
| Organism | Linaria vulgaris | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Wollenweber, J.Plant Physiol.,131,(1987),37 |
|---|
|