| Name |
Soyasaponin I |
| Formula |
C48H78O18 |
| Mw |
942.51881569 |
| CAS RN |
51330-27-9 |
| C_ID |
C00003553
, 
|
| InChIKey |
PTDAHAWQAGSZDD-JWIBFTMRNA-N |
| InChICode |
InChI=1S/C48H78O18/c1-21-29(52)31(54)35(58)40(61-21)65-37-32(55)30(53)24(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-12-13-45(5)25(46(28,6)20-50)11-14-48(8)26(45)10-9-22-23-17-43(2,3)18-27(51)44(23,4)15-16-47(22,48)7/h9,21,23-38,40-42,49-58H,10-20H2,1-8H3,(H,59,60)/t21-,23+,24-,25-,26-,27-,28+,29+,30+,31+,32+,33+,34+,35-,36+,37-,38+,40+,41+,42+,44-,45+,46+,47-,48-/m1/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](OC3[C@H](O[C@H]4CC[C@@]5(C)[C@@H](CC[C@]6(C)[C@@H]5CC=C5[C@@H]7CC(C)(C)C[C@@H](O)[C@]7(C)CC[C@]56C)[C@]4(C)CO)OC(C(=O)O)[C@@H](O)[C@@H]3O)OC(CO)[C@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
| Plantae | Fabaceae | Abrus fruticulosus | Ref. |
| Plantae | Fabaceae | Astragalus shikokianus | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Gueldenstaedtia multiflora  | Ref. |
| Plantae | Fabaceae | Lens culinaris  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum L.  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium argutum | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
|
|
zoom in
| Organism | Trifolium argutum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|