| Name |
1-Methyl-beta-carboline Harman Harmane Indoter Locuturin Zygofabagine |
| Formula |
C12H10N2 |
| Mw |
182.08439833 |
| CAS RN |
486-84-0 |
| C_ID |
C00001736
, 
|
| InChIKey |
PSFDQSOCUJVVGF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| SMILES |
Cc1nccc2c1[nH]c1ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens Linn. | Ref. |
| Plantae | Apocynaceae | Kopsia griffithii | Ref. |
| Plantae | Apocynaceae | Rauwolfia verticillata | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Cyperaceae | Carex brevicollis DC.  | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus angustifolia L.  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Malpighiaceae | Banisteriopsis caapi(Spr. Ex Briesb.) | Ref. |
| Plantae | Malvaceae | Grewia bicolor Juss.  | Ref. |
| Plantae | Nitrariaceae | Peganum harmala L.  | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata  | Ref. |
| Plantae | Passifloraceae | Passiflora spp. | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Rubiaceae | Arariba rubra | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza japonica Bl. | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza kuroiwai | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Psychotria viridis | Ref. |
| Plantae | Rubiaceae | Uncaria attenuata Korth | Ref. |
| Plantae | Rubiaceae | Uncaria canescens Korth | Ref. |
| Plantae | Rubiaceae | Uncaria orientalis Guill. | Ref. |
| Plantae | Symplocaceae | Symplocos racemosa  | Ref. |
| Plantae | Symplocaceae | Symplocos setchuensis | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris L.  | Ref. |
| Plantae | Zygophyllaceae | Zygophyllum fabago  | Ref. |
| - | - | Cribiceflina cribaria | Ref. |
| - | - | Simira rubra(Mart.)Steyerm. | Ref. |
|
|
zoom in
| Organism | Plumbago zeylanica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|