| Name |
Cupressuflavone |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
3952-18-9 |
| C_ID |
C00001034
, 
|
| InChIKey |
LADPNODMUXOPRG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)23-11-21(37)25-17(33)9-19(35)27(29(25)39-23)28-20(36)10-18(34)26-22(38)12-24(40-30(26)28)14-3-7-16(32)8-4-14/h1-12,31-36H |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Agathis dammara | Ref. |
| Plantae | Araucariaceae | Agathis palmerstoni | Ref. |
| Plantae | Araucariaceae | Araucaria bidwillii  | Ref. |
| Plantae | Casuarinaceae | Casuarina cunninghamiana | Ref. |
| Plantae | Cupressaceae | Cupressus arizonica | Ref. |
| Plantae | Cupressaceae | Cupressus cashmeriana | Ref. |
| Plantae | Cupressaceae | Cupressus sempervirens  | Ref. |
| Plantae | Cupressaceae | Cupressus spp. | Ref. |
| Plantae | Cupressaceae | Cupressus torulosa | Ref. |
| Plantae | Cupressaceae | Juniperus horizontalis | Ref. |
| Plantae | Cupressaceae | Juniperus occidentalis HOOK.  | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
| Plantae | Salicaceae | Salix alba  | Ref. |
| Plantae | Salicaceae | Salix fragilis  | Ref. |
|
|
zoom in
| Organism | Salix alba | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Murti,Bull.Nat.Inst.Sci.India,31,(1965),11
Murti,Bull.Nat.Inst.Sci.India,34,(1967),161 |
|---|
|