| Name |
Isoborneol, acetate Isobornyl acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
125-12-2 |
| C_ID |
C00050879
|
| InChIKey |
KGEKLUUHTZCSIP-BEYHTBJANA-N |
| InChICode |
InChI=1/C12H20O2/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h9-10H,5-7H2,1-4H3/t9-,10-,12+/s2 |
| SMILES |
CC(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|