| Name |
Phellopterin |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
2543-94-4 |
| C_ID |
C00030987
, 
|
| InChIKey |
BMLZFLQMBMYVHG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H16O5/c1-10(2)6-8-21-17-15-12(7-9-20-15)14(19-3)11-4-5-13(18)22-16(11)17/h4-7,9H,8H2,1-3H3 |
| SMILES |
COc1c2ccoc2c(OCC=C(C)C)c2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica dahurica var.dahurica  | Ref. |
| Plantae | Apiaceae | Angelica glabra | Ref. |
| Plantae | Apiaceae | Angelica komarovii | Ref. |
| Plantae | Apiaceae | Angelica taiwaniana | Ref. |
| Plantae | Apiaceae | Heracleum asperum | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apiaceae | Heracleum mantegazzianium | Ref. |
| Plantae | Apiaceae | Heracleum mantegazzianum | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance | Ref. |
| Plantae | Apiaceae | Heracleum ponticum | Ref. |
| Plantae | Apiaceae | Heracleum sphondylium  | Ref. |
| Plantae | Apiaceae | Heracleum woroschiklowii | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Peucedanum baicalense | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Ptelea trifolia | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| - | - | Archangelica decurrens | Ref. |
| - | - | Komarovia anisospermum | Ref. |
|
|
zoom in
| Organism | Notopterygium incisum | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., CCMM, 21, (1996), 295.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Ban, et al., Planta Med, 69, (2003), 408 |
|---|
|