| Name |
Methylparaben p-Methoxycarbonylphenol Methyl 4-hydroxybenzoate |
| Formula |
C8H8O3 |
| Mw |
152.04734412 |
| CAS RN |
99-76-3 |
| C_ID |
C00030751
, 
|
| InChIKey |
LXCFILQKKLGQFO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5,9H,1H3 |
| SMILES |
COC(=O)c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Elaphomycetaceae | Monascus pilosus BCRC38072 | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia elegans  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Lauraceae | Machilus zuihoensis | Ref. |
| Plantae | Lauraceae | Neolitsea acuminatissima | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Rubiaceae | Palicourea coriacea | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|