| Name |
2-(4-Hydroxyphenyl)ethanol
4-(2-Hydroxyethyl)phenol
p-Hydroxyphenethyl alcohol
p-Tyrosol
Tyrosol
2-(p-Hydroxyphenyl)ethanol |
| Formula |
C8H10O2 |
| Mw |
138.06807956 |
| CAS RN |
501-94-0 |
| C_ID |
C00029515
, 
|
| InChIKey |
YCCILVSKPBXVIP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H10O2/c9-6-5-7-1-3-8(10)4-2-7/h1-4,9-10H,5-6H2 |
| SMILES |
OCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Gloeophyllaceae | Gloeophyllum sp.97022 | Ref. |
| Fungi | Trichocomaceae | Penicillium sp. | Ref. |
| Plantae | Berberidaceae | Sinopodophyllum emodi (WALL.) YING | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata (HOOK.f.et Thoms.) H.OHBA | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis | Ref. |
| Plantae | Cruciferae | Raphanus sativus | Ref. |
| Plantae | Euphorbiaceae | Croton chilensis | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Meliaceae | Azadirachta indica | Ref. |
| Plantae | Oleaceae | Fraxinus americana | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum | Ref. |
| Plantae | Oleaceae | Olea europaea | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Solanaceae | Datura metel | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| - | - | Arganis spinosa | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Nigrospora sp. PSU-F18 | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
