| Name |
Purpureine (+)-Purpureine Thalicsimidin Thalicsimidine |
| Formula |
C22H27NO5 |
| Mw |
385.18892298 |
| CAS RN |
19775-47-4 |
| C_ID |
C00027492
, 
|
| InChIKey |
KMLPLPOAFAPFFE-GGYSOQFKNA-N |
| InChICode |
InChI=1S/C22H27NO5/c1-23-8-7-13-18-15(23)9-12-10-16(24-2)17(25-3)11-14(12)19(18)21(27-5)22(28-6)20(13)26-4/h10-11,15H,7-9H2,1-6H3/t15-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)-c1c(OC)c(OC)c(OC)c3c1[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Rollinia mucosa  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Ranunculaceae | Thalictrum cultratum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum filamentosum | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae | Thalictrum ichangense | Ref. |
| Plantae | Ranunculaceae | Thalictrum ichengense | Ref. |
| Plantae | Ranunculaceae | Thalictrum microgynum | Ref. |
| Plantae | Ranunculaceae | Thalictrum pedunculatum | Ref. |
| Plantae | Ranunculaceae | Thalictrum simplex | Ref. |
| Plantae | Ranunculaceae | Thalictrum strictum | Ref. |
| Plantae | Ranunculaceae | Thalictrum symplex | Ref. |
| - | - | Elastostema sinuata | Ref. |
|
|
zoom in
| Organism | Thalictrum strictum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Wang, et al., CTHD, 23, (1992), 236.
Hussain, et al., Stud Org Chem(Amsterdam), 26, (1986), 155.
Wu, et al., Zhongguo Yaoke Daxue Xuebao, 19, (1988), 239.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|