| Name |
Leucopelargonidin 3,4,5,7,4'-Flavanpentol |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
520-17-2 |
| C_ID |
C00020638
, 
|
| InChIKey |
FSVMLWOLZHGCQX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,13-20H/t13-,14-,15+/m0/s1 |
| SMILES |
Oc1ccc(C2Oc3cc(O)cc(O)c3C(O)C2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Connaraceae | Rourea santaloides | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Albizia lebbek | Ref. |
| Plantae | Fabaceae | Anadenanthera peregrina  | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Fabaceae | Cassia javanica  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Senna auriculata | Ref. |
| Plantae | Fabaceae | Senna singueana  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L. var. aurantiaca  | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Polygonaceae | Rumex hymenosepalus | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Rumex hymenosepalus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|