| Name |
Pebrellin 5,6-Dihydroxy-7,8,3',4'-tetramethoxyflavone 2-(3,4-Dimethoxyphenyl)-5,6-dihydroxy-7,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
13509-93-8 |
| C_ID |
C00013339
, 
|
| InChIKey |
AREVFHPDZQHBHI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-11-6-5-9(7-13(11)24-2)12-8-10(20)14-15(21)16(22)18(25-3)19(26-4)17(14)27-12/h5-8,21-22H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(O)c(OC)c(OC)c3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mentha spicata  | Ref. |
| Plantae | Labiatae | Mentha x piperita | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Satureja salzmannii | Ref. |
| Plantae | Labiatae | Thymus membranaceus | Ref. |
| Plantae | Labiatae | Thymus piperella  | Ref. |
|
|
zoom in
| Organism | Origanum vulgare subsp. Hirtum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|