| Name |
Harpagide 7-acetate 8-Acetylharpagide 8-O-Acetylharpagide |
| Formula |
C17H26O11 |
| Mw |
406.14751167 |
| CAS RN |
6926-14-3 |
| C_ID |
C00010570
, 
|
| InChIKey |
CAFTUQNGDROXEZ-LDZUGCFSNA-N |
| InChICode |
InChI=1S/C17H26O11/c1-7(19)28-16(2)5-9(20)17(24)3-4-25-15(13(16)17)27-14-12(23)11(22)10(21)8(6-18)26-14/h3-4,8-15,18,20-24H,5-6H2,1-2H3/t8-,9-,10-,11+,12+,13-,14-,15+,16+,17+/m1/s1 |
| SMILES |
CC(=O)O[C@@]1(C)C[C@@H](O)[C@]2(O)C=CO[C@@H](OC3OC(CO)[C@@H](O)[C@H](O)C3O)[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ajuga decumbens  | Ref. |
| Plantae | Labiatae | Ajuga pyramidalis | Ref. |
| Plantae | Labiatae | Ajuga remota  | Ref. |
| Plantae | Labiatae | Ajuga reptans  | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Labiatae | Caryopteris x Clandonensis | Ref. |
| Plantae | Labiatae | Lamium galeobdolon L. ssp. galeobdolon | Ref. |
| Plantae | Labiatae | Leonurus persicus | Ref. |
| Plantae | Labiatae | Melittis melissophyllum  | Ref. |
| Plantae | Labiatae | Otostegia integrifolia  | Ref. |
| Plantae | Lamiaceae | Lamiastrum galeobdolon flavidum(L.)Ehrend et Polatschek. | Ref. |
| Plantae | Poaceae | Tribolium castaneum | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ilwensis | Ref. |
|
|
zoom in
| Organism | Scrophularia ilwensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|