| Name |
2'-Hydroxygenistein |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
1156-78-1 |
| C_ID |
C00009453
, 
|
| InChIKey |
GSSOWCUOWLMMRJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-7-1-2-9(11(18)3-7)10-6-21-13-5-8(17)4-12(19)14(13)15(10)20/h1-6,16-19H |
| SMILES |
O=c1c(-c2ccc(O)cc2O)coc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cajanus cajan  | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Dolichos biflorus  | Ref. |
| Plantae | Fabaceae | Lablab niger | Ref. |
| Plantae | Fabaceae | Laburnum anagyroides  | Ref. |
| Plantae | Fabaceae | Lupinus albus L.  | Ref. |
| Plantae | Fabaceae | Lupinus angustifolius  | Ref. |
| Plantae | Fabaceae | Lupinus arcticus | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Moghania macrophylla | Ref. |
| - | - | Moghania philippinensis | Ref. |
|
|
zoom in
| Organism | Spartium junceum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Biggs,Aust.J.Chem.,28,(1975),1389
Prasad,Phytochem.,16,(1977),1120 |
|---|
|