| Name |
Astilbin |
| Formula |
C21H22O11 |
| Mw |
450.11621155 |
| CAS RN |
29838-67-3 |
| C_ID |
C00008703
, 
|
| InChIKey |
ZROGCCBNZBKLEL-ZREKOUTKNA-N |
| InChICode |
InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3/t7-,15-,17+,18-,19+,20+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@H]2C(=O)c3c(O)cc(O)cc3O[C@@H]2c2ccc(O)c(O)c2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Cunoniaceae | Eucryphia cordifolia | Ref. |
| Plantae | Ericaceae | Lyonia ovalifolia  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Lauraceae | Litsea glauca | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Loranthaceae | Taxillus kaempferi | Ref. |
| Plantae | Quintiniaceae | Quintinia serrata | Ref. |
| Plantae | Saxifragaceae | Astilbe odontophylla Miq. var. congesta | Ref. |
| Plantae | Saxifragaceae | Astilbe thunbergii | Ref. |
| Plantae | Smilacaceae | Smilax bockii | Ref. |
| Plantae | Smilacaceae | Smilax glabra  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Sphaerostephanos arbuscula | Ref. |
|
|
zoom in
| Organism | Astilbe thunbergii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 829,Flavanones and dihydroflavonols
Cambie,J.Chem.Soc.,(1959),848
Gaffield,J.Org.Chem.40,(1975),8 |
|---|
|