| Name |
Hyacinthin Cyanidin 3-(6-O-p-coumarylglucoside) |
| Formula |
C30H27O13 |
| Mw |
595.14516595 |
| CAS RN |
56767-17-0 |
| C_ID |
C00006800
, 
|
| InChIKey |
QAOBEOXFSUJDJL-LHXYVNGMNA-O |
| InChICode |
InChI=1S/C30H26O13/c31-16-5-1-14(2-6-16)3-8-25(36)40-13-24-26(37)27(38)28(39)30(43-24)42-23-12-18-20(34)10-17(32)11-22(18)41-29(23)15-4-7-19(33)21(35)9-15/h1-12,24,26-28,30,37-39H,13H2,(H4-,31,32,33,34,35,36)/p+1/t24-,26-,27-,28-,30-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Fabaceae | Podalyria spp. | Ref. |
| Plantae | Fabaceae | Virgilia spp. | Ref. |
| Plantae | Grossulariaceae | Ribes grossularia  | Ref. |
| Plantae | Hyacinthaceae | Hyacinthus orientalis | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Theaceae | Camellia hiemalis | Ref. |
| Plantae | Theaceae | Camellia japonica  | Ref. |
| Plantae | Theaceae | Camellia sasanqua  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Camellia sasanqua | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,3,(1964),151
Saito,Phytochem.,26,(1987),2761 |
|---|
|