| Name |
5,7,4'-Trihydroxy-3,8-dimethoxyflavone Herbacetin 3,8-dimethyl ether 3,8-Dimethylherbacetin 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
14965-09-4 |
| C_ID |
C00004615
, 
|
| InChIKey |
QEXFTGWTWYZALN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-15-11(20)7-10(19)12-13(21)17(23-2)14(24-16(12)15)8-3-5-9(18)6-4-8/h3-7,18-20H,1-2H3 |
| SMILES |
COc1c(-c2ccc(O)cc2)oc2c(OC)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis sarothroides | Ref. |
| Plantae | Asteraceae | Brachyglottis cassinioides | Ref. |
| Plantae | Asteraceae | Chrysothamnus nauseosus | Ref. |
| Plantae | Asteraceae | Encelia spp. | Ref. |
| Plantae | Asteraceae | Geraea spp. | Ref. |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Asteraceae | Haplopappus deserticola  | Ref. |
| Plantae | Asteraceae | Ozothamnus spp. | Ref. |
| Plantae | Asteraceae | Psiadia trinervia | Ref. |
| Plantae | Calceolariaceae | Calceolaria arachnoidea | Ref. |
| Plantae | Capparaceae | Cleome spinosa  | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Labiatae | Cyanostegia angustifolia | Ref. |
| Plantae | Labiatae | Cyanostegia microphylla | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Zygophyllaceae | Fagonia bruguieri  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Cyanostegia angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ghisalberti,Aust.J.Chem.,20,(1967),1049 |
|---|
|