| Name |
5-Demethylnobiletin |
| Formula |
C20H20O8 |
| Mw |
388.11581762 |
| CAS RN |
2174-59-6 |
| C_ID |
C00003936
, 
|
| InChIKey |
DOFJNFPSMUCECH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O8/c1-23-12-7-6-10(8-14(12)24-2)13-9-11(21)15-16(22)18(25-3)20(27-5)19(26-4)17(15)28-13/h6-9,22H,1-5H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Cunila incana | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mentha spicata  | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Ocimum americanum var. americanum  | Ref. |
| Plantae | Labiatae | Satureja montana  | Ref. |
| Plantae | Labiatae | Sideritis jahandiezii | Ref. |
| Plantae | Labiatae | Sideritis mugronensis | Ref. |
| Plantae | Labiatae | Thymus sp. | Ref. |
| Plantae | Plantaginaceae | Antirrhinum graniticum | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus tangerina  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| - | - | Xinhui citrus | Ref. |
|
|
zoom in
| Organism | Citrus reticulata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Geissman,Chemistry of the Flavonoid Compounds,(1962),429,Pergamon Press
Tomas-Barberan,Phytochem.,27,(1988),165 |
|---|
|