| Name |
Neoxanthin Folioxanthin |
| Formula |
C40H56O4 |
| Mw |
600.41786028 |
| CAS RN |
14660-91-4 |
| C_ID |
C00003780
, 
|
| InChIKey |
PGYAYSRVSAJXTE-ALKGEJJMNA-N |
| InChICode |
InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35-36(5,6)25-33(41)27-38(35,9)43)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-21,23-24,33-34,41-43H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,24-23+,29-15+,30-16+,31-19+,32-20+/t22?,33-,34-,38+,39+,40-/m0/s1 |
| SMILES |
C/C(C=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=C[C@@]12O[C@]1(C)C[C@@H](O)CC2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Tagetes erecta L.  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Ceratophyllaceae | Ceratophyllum demersum  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica rapa ssp. chinensis  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Passifloraceae | Passiflora edulis  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Potamogetonaceae | Potamogeton perfoliatus  | Ref. |
| Plantae | Ranunculaceae | Caltha palustris  | Ref. |
| Plantae | Rosaceae | Geum spp. | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Prunus domestica  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Caffea sp. | Ref. |
|
|
zoom in
| Organism | Dioscorea bulbifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|