| Name |
Orchinol 2,4-Dimethoxy-7-hydroxy-9,10-dihydrophenanthrene |
| Formula |
C16H16O3 |
| Mw |
256.10994438 |
| CAS RN |
41060-20-2 |
| C_ID |
C00002892
, 
|
| InChIKey |
HOVUVTNDNLNINP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H16O3/c1-18-13-8-11-4-3-10-7-12(17)5-6-14(10)16(11)15(9-13)19-2/h5-9,17H,3-4H2,1-2H3 |
| SMILES |
COc1cc2c(c(OC)c1)-c1ccc(O)cc1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium grandiflorum var. thunbergianum  | Ref. |
| Plantae | Orchidaceae | Agrostophyllum callosum | Ref. |
| Plantae | Orchidaceae | Anacamptis pyramidalis  | Ref. |
| Plantae | Orchidaceae | Coeloglossum viride | Ref. |
| Plantae | Orchidaceae | Coelogyne elata | Ref. |
| Plantae | Orchidaceae | Coelogyne ochracea | Ref. |
| Plantae | Orchidaceae | Gymnadenia albida | Ref. |
| Plantae | Orchidaceae | Nigritella nigra | Ref. |
| Plantae | Orchidaceae | Orchis mascula  | Ref. |
| Plantae | Orchidaceae | Orchis militaris  | Ref. |
| Plantae | Orchidaceae | Orchis sambucina | Ref. |
| Plantae | Orchidaceae | Serapias lingua | Ref. |
| - | - | Gymandenia albida | Ref. |
|
|
zoom in
| Organism | Gymandenia albida | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|