| Name |
Rubiadin 1,3-Dihydroxy-2-methyl-9,10-anthraquinone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
117-02-2 |
| C_ID |
C00002862
, 
|
| InChIKey |
IRZTUXPRIUZXMP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c1-7-11(16)6-10-12(13(7)17)15(19)9-5-3-2-4-8(9)14(10)18/h2-6,16-17H,1H3 |
| SMILES |
Cc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Tectona grandis  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Rubiaceae | Coprosma linariifolia Hook.f. | Ref. |
| Plantae | Rubiaceae | Coprosma robusta  | Ref. |
| Plantae | Rubiaceae | Coprosma rotundifolia | Ref. |
| Plantae | Rubiaceae | Coprosma spp. | Ref. |
| Plantae | Rubiaceae | Coprosma tenuicaulis | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Hedyotis capitellata  | Ref. |
| Plantae | Rubiaceae | Hymenodictyon excelsum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Morinda tinctoria var.tomentosa.  | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Plocama pendula | Ref. |
| Plantae | Rubiaceae | Prismatomeris tetrandra | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum  | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
| - | - | Commitheca liebrechtsiana | Ref. |
| - | - | Proclema pendula | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|