| Name |
p-Hydroxyacetophenone Piceol 4'-Hydroxyacetophenone |
| Formula |
C8H8O2 |
| Mw |
136.0524295 |
| CAS RN |
99-93-4 |
| C_ID |
C00002698
, 
|
| InChIKey |
TXFPEBPIARQUIG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O2/c1-6(9)7-2-4-8(10)5-3-7/h2-5,10H,1H3 |
| SMILES |
CC(=O)c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Apocynum cannabinum | Ref. |
| Plantae | Asteraceae | Ophryosporus floribundus | Ref. |
| Plantae | Asteraceae | Robinsonecio gerberifolius | Ref. |
| Plantae | Asteraceae | Saussurea laniceps | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea glehnii | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis cv.Valencia  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Solanaceae | Fabiana imbricata  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|