| Name |
Peucedanin |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
133-26-6 |
| C_ID |
C00002491
, 
|
| InChIKey |
YQBNJPACAUPNLV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O4/c1-8(2)14-15(17-3)10-6-9-4-5-13(16)18-11(9)7-12(10)19-14/h4-8H,1-3H3 |
| SMILES |
COc1c(C(C)C)oc2cc3oc(=O)ccc3cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica decursiva  | Ref. |
| Plantae | Apiaceae | Anthriscus cerefolium  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Meum athamanticum  | Ref. |
| Plantae | Apiaceae | Myrrhis odorata  | Ref. |
| Plantae | Apiaceae | Pastinaca silvestris | Ref. |
| Plantae | Apiaceae | Peucedanum morisonii | Ref. |
| Plantae | Apiaceae | Peucedanum officinale  | Ref. |
| Plantae | Apiaceae | Peucedanum ruthenicum | Ref. |
| Plantae | Apiaceae | Peucedanum stenocarpum | Ref. |
| Plantae | Apiaceae | Peucedanum tauricum | Ref. |
| Plantae | Apiaceae | Prangos pabularia  | Ref. |
| - | - | Oppopanax chironium | Ref. |
|
|
zoom in
| Organism | Oppopanax chironium | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Marquez, et al., Planta Med, 70, (2004), 1016 |
|---|
|