| Name |
Echimidine |
| Formula |
C20H31NO7 |
| Mw |
397.21005235 |
| CAS RN |
520-68-3 |
| C_ID |
C00002085
, 
|
| InChIKey |
HRSGCYGUWHGOPY-IDXYNAKJNA-N |
| InChICode |
InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15+,16+,20-/m0/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@@H]1CCN2CC=C(COC(=O)[C@@](O)([C@H](C)O)C(C)(C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Echium italicum  | Ref. |
| Plantae | Boraginaceae | Echium lycopsis | Ref. |
| Plantae | Boraginaceae | Echium plantagineum  | Ref. |
| Plantae | Boraginaceae | Symphytum aintabicum | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum bohemium | Ref. |
| Plantae | Boraginaceae | Symphytum caucasium | Ref. |
| Plantae | Boraginaceae | Symphytum consolidum | Ref. |
| Plantae | Boraginaceae | Symphytum grandiflorum | Ref. |
| Plantae | Boraginaceae | Symphytum ibericum | Ref. |
| Plantae | Boraginaceae | Symphytum officinale  | Ref. |
| Plantae | Boraginaceae | Symphytum orientale | Ref. |
| Plantae | Boraginaceae | Symphytum tanaiense | Ref. |
| Plantae | Boraginaceae | Symphytum tuberosum | Ref. |
| Plantae | Boraginaceae | Symphytum uplandicum | Ref. |
|
|
zoom in
| Organism | Symphytum tanaiense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|