| Name |
Ethyl acetate |
| Formula |
C4H8O2 |
| Mw |
88.0524295 |
| CAS RN |
141-78-6 |
| C_ID |
C00001308
, 
|
| InChIKey |
XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| SMILES |
CCOC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Nectriaceae | Fusarium poae | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Asteraceae | Anthemis nobilis  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Croton lechleri Mull.Arg.  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Durio zibethinus  | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Orchidaceae | Dendrobium superbum | Ref. |
| Plantae | Polygonaceae | Rumex thyrsiflorus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Winteraceae | Exospermum stipitatum | Ref. |
| Plantae | Winteraceae | Zygogynum spp. | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Helicobacter pylori | Ref. |
|
|
zoom in
| Organism | Sida galheirensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|