| Name |
Acteoside Verbascoside Kusaginin |
| Formula |
C29H36O15 |
| Mw |
624.20542048 |
| CAS RN |
61276-17-3 |
| C_ID |
C00002783
, 
|
| InChIKey |
FBSKJMQYURKNSU-OQSHRHNDNA-N |
| InChICode |
InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23-,24+,25+,26+,27+,28+,29-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@@H]2C(O)[C@H](OCCc3ccc(O)c(O)c3)OC(CO)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ebracteatus | Ref. |
| Plantae | Acanthaceae | Acanthus ilicifolius  | Ref. |
| Plantae | Acanthaceae | Asystasia intrusa | Ref. |
| Plantae | Acanthaceae | Barleria lupulina  | Ref. |
| Plantae | Acanthaceae | Barleria prionitis  | Ref. |
| Plantae | Acanthaceae | Barleria strigosa  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Acanthaceae | Strobilanthes cusia BREMEK  | Ref. |
| Plantae | Bignoniaceae | Barnettia kerrii | Ref. |
| Plantae | Bignoniaceae | Dolichandrone serrulata | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Bignoniaceae | Kigelia africana  | Ref. |
| Plantae | Bignoniaceae | Markhamia lutea  | Ref. |
| Plantae | Bignoniaceae | Markhamia stipulata  | Ref. |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Buddlejaceae | Buddleja cordata | Ref. |
| Plantae | Buddlejaceae | Buddleja globosa  | Ref. |
| Plantae | Buddlejaceae | Buddleja globose | Ref. |
| Plantae | Buddlejaceae | Buddleja officinalis  | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Gesneriaceae | Conandron ramoidioides | Ref. |
| Plantae | Gesneriaceae | Lysionotus pauciflorus  | Ref. |
| Plantae | Globulariaceae | Globularia davisiana | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Labiatae | Callicarpa formosana  | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Lamium garganicum | Ref. |
| Plantae | Labiatae | Lamium purpureum L.  | Ref. |
| Plantae | Labiatae | Leucosceptrum japonicum | Ref. |
| Plantae | Labiatae | Marrubium vulgare  | Ref. |
| Plantae | Labiatae | Phlomis anisodonta | Ref. |
| Plantae | Labiatae | Phlomis bruguieri | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Phlomis caucasica | Ref. |
| Plantae | Labiatae | Phlomis grandiflora var. grandiflora | Ref. |
| Plantae | Labiatae | Phlomis lanceolata | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Firmiana platanifolia | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Oleaceae | Abeliophyllum distichum Nakai | Ref. |
| Plantae | Oleaceae | Fontanesia fortunei Carr. | Ref. |
| Plantae | Oleaceae | Fontanesia phillyreoides Labill. | Ref. |
| Plantae | Oleaceae | Forsythia japonica Makino | Ref. |
| Plantae | Oleaceae | Forsythia koreana (Rehd.) Nakai | Ref. |
| Plantae | Oleaceae | Forsythia spp. | Ref. |
| Plantae | Oleaceae | Forsythia viridissima Lindl. | Ref. |
| Plantae | Oleaceae | Fraxinus americana | Ref. |
| Plantae | Oleaceae | Fraxinus americana L. | Ref. |
| Plantae | Oleaceae | Fraxinus excelsior L.  | Ref. |
| Plantae | Oleaceae | Fraxinus griffithii C.B.Clarke  | Ref. |
| Plantae | Oleaceae | Fraxinus malacophylla Hemsl. | Ref. |
| Plantae | Oleaceae | Fraxinus ornus L.  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarpa Willd. | Ref. |
| Plantae | Oleaceae | Fraxinus uhdei (Wenzig) Lingelsh. | Ref. |
| Plantae | Oleaceae | Jasminum amplexicaule Buch.-Ham. | Ref. |
| Plantae | Oleaceae | Jasminum mesnyi Hance | Ref. |
| Plantae | Oleaceae | Jasminum nudiflorum | Ref. |
| Plantae | Oleaceae | Jasminum polyanthum Franch. | Ref. |
| Plantae | Oleaceae | Ligustrum obtusifolium Sieb.et Zucc.  | Ref. |
| Plantae | Oleaceae | Ligustrum robustum | Ref. |
| Plantae | Oleaceae | Olea europaea L.  | Ref. |
| Plantae | Oleaceae | Osmanthus fragrans (Thunb.) Lour.  | Ref. |
| Plantae | Oleaceae | Osmanthus heterophyllus (G.Don) P.S.Green  | Ref. |
| Plantae | Oleaceae | Syringa reticulata (Blume) Hara | Ref. |
| Plantae | Oleaceae | Syringa vulgaris L.  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Orobanchaceae | Cistanche salsa | Ref. |
| Plantae | Orobanchaceae | Orobanche coerulescens  | Ref. |
| Plantae | Orobanchaceae | Orobanche rapum | Ref. |
| Plantae | Orobanchaceae | Pedicularis condensata | Ref. |
| Plantae | Orobanchaceae | Pedicularis muscicola | Ref. |
| Plantae | Orobanchaceae | Pedicularis nordmanniana | Ref. |
| Plantae | Orobanchaceae | Pedicularis resupinata oppositifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis sibthorpii | Ref. |
| Plantae | Orobanchaceae | Pedicularis wilhelmsiana | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Pedaliaceae | Harpagophytum procumbens  | Ref. |
| Plantae | Plantaginaceae | Chelone obliqua | Ref. |
| Plantae | Plantaginaceae | Plantago afra  | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Plantago altissima  | Ref. |
| Plantae | Plantaginaceae | Plantago arborescens | Ref. |
| Plantae | Plantaginaceae | Plantago arenaria  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago australis | Ref. |
| Plantae | Plantaginaceae | Plantago bellardi | Ref. |
| Plantae | Plantaginaceae | Plantago bellardii | Ref. |
| Plantae | Plantaginaceae | Plantago cretica | Ref. |
| Plantae | Plantaginaceae | Plantago hookeriana | Ref. |
| Plantae | Plantaginaceae | Plantago lagopus | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago lundborgii | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago myosuros  | Ref. |
| Plantae | Plantaginaceae | Plantago nivalis | Ref. |
| Plantae | Plantaginaceae | Plantago ovata  | Ref. |
| Plantae | Plantaginaceae | Plantago patagonica | Ref. |
| Plantae | Plantaginaceae | Plantago raoulii | Ref. |
| Plantae | Plantaginaceae | Plantago sempervirens | Ref. |
| Plantae | Plantaginaceae | Plantago stauntonii | Ref. |
| Plantae | Plantaginaceae | Plantago subspathulata | Ref. |
| Plantae | Plantaginaceae | Plantago subulata | Ref. |
| Plantae | Plantaginaceae | Plantago uniflora | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Plantaginaceae | Sibthorpia africana L. | Ref. |
| Plantae | Plantaginaceae | Sibthorpia europea L. | Ref. |
| Plantae | Plantaginaceae | Veronica austriaca L.  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Camptoloma lyperiiflorum (Vatke) Hillard | Ref. |
| Plantae | Scrophulariaceae | Ellisiophyllum pinnatum (Wall.ex.Benth.) | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia auriculata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia canina  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa L.  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia scopolii | Ref. |
| Plantae | Scrophulariaceae | Scrophularia striata  | Ref. |
| Plantae | Scrophulariaceae | Verbascum mallophorum  | Ref. |
| Plantae | Scrophulariaceae | Verbascum phlomoides  | Ref. |
| Plantae | Scrophulariaceae | Verbascum sinuatum  | Ref. |
| Plantae | Scrophulariaceae | Verbascum wiedemannianum | Ref. |
| Plantae | Verbenaceae | Lantana sp. | Ref. |
| Plantae | Verbenaceae | Lippia alba  | Ref. |
| Plantae | Verbenaceae | Lippia dulcis TREV. | Ref. |
| Plantae | Verbenaceae | Verbena bonariensis  | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
| Plantae | Verbenaceae | Verbena littoralis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Verbenaceae | Verbenoxylum reitzii | Ref. |
| - | - | Baphicacanthus cusia  | Ref. |
| - | - | Galeobdolon chinense | Ref. |
| - | - | Pentemon gentianoides HBK | Ref. |
| - | - | Pithecotenium crucigerum (L.) A.H Gentry | Ref. |
|
|
zoom in
| Organism | Veronica polita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|