| Name |
3-Octanone Octan-3-one |
| Formula |
C8H16O |
| Mw |
128.12011513 |
| CAS RN |
106-68-3 |
| C_ID |
C00034765
, 
|
| InChIKey |
RHLVCLIPMVJYKS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h3-7H2,1-2H3 |
| SMILES |
CCCCCC(=O)CC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Cancer cells) | Ref. |
| Fungi | Polyporaceae | Lentinus edodes  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula multifida  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta temuifolia | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Lavandin abrialis | Ref. |
| - | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
| Organism | Schizonepeta temuifolia | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979) |
|---|
|