| Name |
Methyl 3,4,5-trihydroxybenzoate
Methyl gallate |
| Formula |
C8H8O5 |
| Mw |
184.03717337 |
| CAS RN |
99-24-1 |
| C_ID |
C00030754
, 
|
| InChIKey |
FBSFWRHWHYMIOG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O5/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,9-11H,1H3 |
| SMILES |
COC(=O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Dictyotaceae | Spatoglossum variabile | Ref. |
| Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch | Ref. |
| Plantae | Anacardiaceae | Rhus chinensis | Ref. |
| Plantae | Betulaceae | Carpinus cordata | Ref. |
| Plantae | Casuarinaceae | Casuarina equisetifolia | Ref. |
| Plantae | Combretaceae | Combretum quadrangulare | Ref. |
| Plantae | Combretaceae | Terminalia superba | Ref. |
| Plantae | Commelinaceae | Commelina communis | Ref. |
| Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
| Plantae | Euphorbiaceae | Euphorbia jolkini | Ref. |
| Plantae | Euphorbiaceae | Macaranga barteri | Ref. |
| Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
| Plantae | Fabaceae | Tachigalia paniculata | Ref. |
| Plantae | Geraniaceae | Geranium niveum | Ref. |
| Plantae | Geraniaceae | Geranium pratense subsp.finitimum (Woronow) Knuth | Ref. |
| Plantae | Lythraceae | Lagerstroemia indica | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Meliaceae | Toona sinensis | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba | Ref. |
| Plantae | Paeoniaceae | Paeonia emodi | Ref. |
| Plantae | Paeoniaceae | Paeonia hybrida | Ref. |
| Plantae | Rosaceae | Rosa multiflora | Ref. |
| Plantae | Sapindaceae | Acer rubrum L. | Ref. |
| Plantae | Sapindaceae | Koelreuteria paniculata | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| - | - | Haematoxylon campechianum | Ref. |
|
|
zoom in
| Organism | Euphorbia jolkini |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Riaz, et al., Phytochemistry, 65, (2004), 1129.
Kinghorn, et al., Planta Med, 70, (2004), 691 |
|---|
|
