| Name |
Stigmasterol-3-O-beta-D-glucopyranoside beta-Stigmasteryl 3-O-beta-D-glucopyranoside |
| Formula |
C35H58O6 |
| Mw |
574.42333958 |
| CAS RN |
19716-26-8 |
| C_ID |
C00029509
, 
|
| InChIKey |
VWDLOXMZIGUBKM-LBGLFUFANA-N |
| InChICode |
InChI=1S/C35H58O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h8-10,20-22,24-33,36-39H,7,11-19H2,1-6H3/b9-8+/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1 |
| SMILES |
CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Apiaceae | Dorema kopetdaghense | Ref. |
| Plantae | Apiaceae | Ferula persica  | Ref. |
| Plantae | Asteraceae | Eupatorium macrocephalum Lee.  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Clusiaceae-Guttiferae | Allanblackia monticola STANER L.C. | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Ochnaceae | Ouratea sulcata | Ref. |
| Plantae | Polygalaceae | Polygala caudata | Ref. |
| Plantae | Rubiaceae | Coussarea brevicaulis | Ref. |
| Plantae | Rutaceae | Oriciopsis glaberrima ENGL. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Sapindaceae | Lepisanthes rubiginosa  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Turneraceae | Turnera subulata | Ref. |
|
|
zoom in
| Organism | Sida galheirensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|