| Name |
N-Isobutyldeca-trans-2-trans-4-dienamide
Pellitorine |
| Formula |
C14H25NO |
| Mw |
223.19361443 |
| CAS RN |
18836-52-7 |
| C_ID |
C00028813
, 
|
| InChIKey |
QMIWSRNEYNUYFE-HULFFUFUNA-N |
| InChICode |
InChI=1S/C14H25NO/c1-4-6-7-8-9-10-11-12-14(16)15-13(3)5-2/h9-13H,4-8H2,1-3H3,(H,15,16)/b10-9+,12-11+/t13-/m1/s1 |
| SMILES |
CCCCC/C=C/C=C/C(=O)NC(C)CC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia dracunculus  | Ref. |
| Plantae | Piperaceae | Piper kadsura | Ref. |
| Plantae | Piperaceae | Piper longum | Ref. |
| Plantae | Piperaceae | Piper nigrum L. | Ref. |
| Plantae | Piperaceae | Piper pedicellosum | Ref. |
| Plantae | Piperaceae | Piper retrofractum | Ref. |
| Plantae | Piperaceae | Piper sarmentosum | Ref. |
| Plantae | Piperaceae | Piper tuberculatum | Ref. |
| Plantae | Piperaceae | Piper tuberculatum Jacq. | Ref. |
| Plantae | Rutaceae | Fagara xanthoxyloides | Ref. |
| Plantae | Rutaceae | Stauranthus perforatus | Ref. |
| Plantae | Solanaceae | Withania somnifera | Ref. |
|
|
zoom in
| Organism | Withania somnifera |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
