| Name |
Thymidine Deoxythymidine |
| Formula |
C10H14N2O5 |
| Mw |
242.09027157 |
| CAS RN |
50-89-5 |
| C_ID |
C00019698
, 
|
| InChIKey |
IQFYYKKMVGJFEH-GBQWHWSKNA-N |
| InChICode |
InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
| SMILES |
Cc1cn([C@H]2CC(O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Axinellidae | Phakellia mauritiana | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Liliaceae | Fritillaria anhuiensis | Ref. |
| Plantae | Liliaceae | Fritillaria cirrhosa  | Ref. |
| Plantae | Liliaceae | Fritillaria przewalskii  | Ref. |
| Plantae | Liliaceae | Fritillaria ussuriensis  | Ref. |
| Plantae | Liliaceae | Fritillaria verticillata var.thunbergii  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| - | - | Cascuta australis | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
| - | - | Subergorgia suberosa | Ref. |
|
|
zoom in
| Organism | Datura metel | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|