| Name |
6,8-Diprenylgenistein 5,7,4'-Trihydroxy-6,8-diprenylisoflavone 8-(gamma,gamma-Dimethylallyl)wighteone |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
51225-28-6 |
| C_ID |
C00009516
, 
|
| InChIKey |
UCHYSPNEUSDFQR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Euchresta horsfieldii  | Ref. |
| Plantae | Fabaceae | Euchresta japonica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus pilosus | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
|
|
zoom in
| Organism | Millettia pachycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Singhal,Phytochem.,19,(1980),929 |
|---|
|