| Name |
Flavokawin B |
| Formula |
C17H16O4 |
| Mw |
284.104859 |
| CAS RN |
1775-97-9 |
| C_ID |
C00006936
, 
|
| InChIKey |
QKQLSQLKXBHUSO-CMDGGOBGSA-N |
| InChICode |
InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+ |
| SMILES |
COc1cc(O)c(C(=O)/C=C/c2ccccc2)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum oxyphyllum | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Gesneriaceae | Didymocarpus corchorifolia | Ref. |
| Plantae | Lauraceae | Aniba riparia | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
| Plantae | Pinaceae | Pinus excelsa  | Ref. |
| Plantae | Pinaceae | Pinus wallichiana  | Ref. |
| Plantae | Piperaceae | Piper methysticum  | Ref. |
| Plantae | Polygonaceae | Polygonum ferrugineum  | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Zingiberaceae | Alpinia speciosa  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
|
|
zoom in
| Organism | Alpinia speciosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Mahesh,J.Sci.Ind.Res.India.,13B,(1954),835
Hansel,Z.Naturforsch.B.,18,(1963),370 |
|---|
|