| Name |
Cyanidin |
| Formula |
C15H11O6 |
| Mw |
287.05556308 |
| CAS RN |
13306-05-3 |
| C_ID |
C00006614
, 
|
| InChIKey |
VEVZSMAEJFVWIL-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C15H10O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-6H,(H4-,16,17,18,19,20)/p+1 |
| SMILES |
Oc1cc(O)c2cc(O)c(-c3ccc(O)c(O)c3)[o+]c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Bromeliaceae | Aechmea glomerata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus alba 'Sibirica'  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napa | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cupressaceae | Thuja plicata | Ref. |
| Plantae | Cupressaceae | Thuja spp. | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ericaceae | Vaccinium alaskaense | Ref. |
| Plantae | Ericaceae | Vaccinium angustifolium  | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus  | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Ericaceae | Vaccinium uliginosum  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sesbania grandiflora L.  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
| Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Hibiscus mutabilis  | Ref. |
| Plantae | Malvaceae | Malva sylvestris  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Abies grandis | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polygonaceae | Polygonum perfoliatum | Ref. |
| Plantae | Polygonaceae | Polygonum senticosum | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia hybrida | Ref. |
| Plantae | Solanaceae | Solanum tuberosum subsp. Andigena  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spryginii | Ref. |
| Plantae | Vitaceae | Vitis labrusca  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | Aceraceae macrophyllum | Ref. |
|
|
zoom in
| Organism | Thuja spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter, Ann.,401,'1913),189 |
|---|
|