| Name |
3-O-Methylquercetin 7-O-beta-D-glucopyranoside Quercetin 3-methyl ether 7-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
26931-68-0 |
| C_ID |
C00005491
, 
|
| InChIKey |
LKXBGSZMRNJAST-BAZAILPONA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-21-17(28)15-12(26)5-9(32-22-19(30)18(29)16(27)14(7-23)34-22)6-13(15)33-20(21)8-2-3-10(24)11(25)4-8/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18+,19-,22-/m1/s1 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline alata  | Ref. |
| Plantae | Asteraceae | Artemisia serotina | Ref. |
| Plantae | Asteraceae | Artemisia transiliensis | Ref. |
| Plantae | Asteraceae | Asanthus solidaginifolia | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
| Plantae | Asteraceae | Viguiera spp. | Ref. |
| Plantae | Cactaceae | Opuntia dillenii HAW.  | Ref. |
| Plantae | Cactaceae | Parodia sanguiniflora | Ref. |
| Plantae | Melianthaceae | Francoa sonchifolia | Ref. |
| Plantae | Onagraceae | Oenothera purpusii | Ref. |
| Plantae | Onagraceae | Oenothera rosea  | Ref. |
| Plantae | Onagraceae | Oenothera texensis | Ref. |
| Plantae | Plumbaginaceae | Limonium gmelinii  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
|
|
zoom in
| Organism | Oenothera texensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Chumbalov,Khim.Prir,Soedin.,5,(1969),439
Lksuz,Planta Med.,31,(1977),270 |
|---|
|