| Name |
Kaempferol 3-glucoside-7-rhamnoside Kaempferol-3-beta-D-gluco-7-alpha-L-rhamnoside Kaempferol-3-beta-D-gluco-7-beta-L-rhamnoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
2392-95-2 |
| C_ID |
C00005184
, 
|
| InChIKey |
JYXSWDCPHRTYGU-GHJHJMDPNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20-,21+,22+,23-,26-,27-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2cc(O)c3c(=O)c(O[C@@H]4OC(CO)[C@@H](O)C(O)C4O)c(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aspleniaceae | Asplenium bulbiferum  | Ref. |
| Plantae | Aspleniaceae | Asplenium trichomanes-ramosum | Ref. |
| Plantae | Asteraceae | Centipeda orbicularis  | Ref. |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Celastraceae | Celastrus orbiculatus  | Ref. |
| Plantae | Celastraceae | Euonymus japonicus  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Marah oreganus | Ref. |
| Plantae | Elaeagnaceae | Shepherdia argentea  | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Fabaceae | Coronilla emerus | Ref. |
| Plantae | Fabaceae | Lathyrus sativus  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vigna spp. | Ref. |
| Plantae | Hymenophytaceae | Hymenophyton leptopodum | Ref. |
| Plantae | Malvaceae | Tilia argentea | Ref. |
| Plantae | Ranunculaceae | Delphinium formosum | Ref. |
|
|
zoom in
| Organism | Equisetum telmateja | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Horhammer,Arch.Pharm.(Berl.),294,(1961),685 |
|---|
|