| Name |
Kaempferol 3,7-di-O-glucoside Kaempferol 3,7-O-beta-D-diglucopyranoside Kaempferol 3,7-diglucoside Kaempferol-3,7-diglucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
25615-14-9 |
| C_ID |
C00005182
, 
|
| InChIKey |
XFFQVRFGLSBFON-AVNJKGJRNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(32)20(35)22(37)26(41-14)39-11-5-12(31)16-13(6-11)40-24(9-1-3-10(30)4-2-9)25(19(16)34)43-27-23(38)21(36)18(33)15(8-29)42-27/h1-6,14-15,17-18,20-23,26-33,35-38H,7-8H2/t14-,15-,17-,18-,20+,21-,22-,23-,26-,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)cc2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Narcissus poeticus | Ref. |
| Plantae | Aspleniaceae | Asplenium bulbiferum  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Cruciferae | Sisymbrium spp. | Ref. |
| Plantae | Cucurbitaceae | Marah oreganus | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum debile | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Equisetaceae | Equisetum palustre | Ref. |
| Plantae | Equisetaceae | Equisetum pratense | Ref. |
| Plantae | Equisetaceae | Equisetum sylvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Fabaceae | Trigonella coerulescens | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vicia sepium  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Paeoniaceae | Paeonia albiflora  | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
|
|
zoom in
| Organism | Equisetum pratense | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|