| Name |
6-Methoxykaempferol 3,5,7,4'-Tetrahydroxy-6-methoxyflavone 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
32520-55-1 |
| C_ID |
C00004593
, 
|
| InChIKey |
OGQSUSFDBWGFFJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-16-9(18)6-10-11(13(16)20)12(19)14(21)15(23-10)7-2-4-8(17)5-3-7/h2-6,17-18,20-21H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)cc3)c(O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina espinosara | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
| Plantae | Asteraceae | Baccharis vaccinioides | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea incana | Ref. |
| Plantae | Asteraceae | Chrysactinia mexicana | Ref. |
| Plantae | Asteraceae | Eupatorium altissimum | Ref. |
| Plantae | Asteraceae | Eupatorium areolare | Ref. |
| Plantae | Asteraceae | Eupatorium serotinum | Ref. |
| Plantae | Asteraceae | Heteranthemis viscidehirta | Ref. |
| Plantae | Asteraceae | Heterotheca grandiflora | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus denudatus | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus hilairei | Ref. |
| Plantae | Eriocaulaceae | Paepalanthus ramosus | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
| Plantae | Orchidaceae | Bletilla formosana | Ref. |
| Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
|
|
zoom in
| Organism | Heterotheca grandiflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Lebreton,C.R.Acad.Sci.Ser.C.,272,(1971),1529 |
|---|
|