| Name |
Soyasaponin I |
| Formula |
C48H78O18 |
| Mw |
942.51881569 |
| CAS RN |
51330-27-9 |
| C_ID |
C00003553
, 
|
| InChIKey |
PTDAHAWQAGSZDD-JWIBFTMRNA-N |
| InChICode |
InChI=1S/C48H78O18/c1-21-29(52)31(54)35(58)40(61-21)65-37-32(55)30(53)24(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-12-13-45(5)25(46(28,6)20-50)11-14-48(8)26(45)10-9-22-23-17-43(2,3)18-27(51)44(23,4)15-16-47(22,48)7/h9,21,23-38,40-42,49-58H,10-20H2,1-8H3,(H,59,60)/t21-,23+,24-,25-,26-,27-,28+,29+,30+,31+,32+,33+,34+,35-,36+,37-,38+,40+,41+,42+,44-,45+,46+,47-,48-/m1/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](OC3[C@H](O[C@H]4CC[C@@]5(C)[C@@H](CC[C@]6(C)[C@@H]5CC=C5[C@@H]7CC(C)(C)C[C@@H](O)[C@]7(C)CC[C@]56C)[C@]4(C)CO)OC(C(=O)O)[C@@H](O)[C@@H]3O)OC(CO)[C@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Balsaminaceae | Impatiens siculifer | Ref. |
| Plantae | Fabaceae | Abrus fruticulosus | Ref. |
| Plantae | Fabaceae | Astragalus shikokianus | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Gueldenstaedtia multiflora | Ref. |
| Plantae | Fabaceae | Lens culinaris | Ref. |
| Plantae | Fabaceae | Medicago sativa | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Pisum sativum L. | Ref. |
| Plantae | Fabaceae | Sophora flavescens | Ref. |
| Plantae | Fabaceae | Sophora japonica | Ref. |
| Plantae | Fabaceae | Trifolium argutum | Ref. |
| Plantae | Fabaceae | Trifolium repens | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
|
|
zoom in
| Organism | Sophora flavescens |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Miyao, et al., Planta Med, 64, (1998), 5 |
|---|
|
