| Name |
alpha-Terpinene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
99-86-5 |
| C_ID |
C00003060
, 
|
| InChIKey |
YHQGMYUVUMAZJR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
| SMILES |
CC1=CC=C(C(C)C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Monodora myristica  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Cicuta virosa  | Ref. |
| Plantae | Apiaceae | Coriandrum sativum  | Ref. |
| Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Carpesium abrotanoides | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Conyza newii  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Fabaceae | Trifolium repens L.  | Ref. |
| Plantae | Fagaceae | Quercus coccifera  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Labiatae | Mentha piperita L.  | Ref. |
| Plantae | Labiatae | Mosla dianthera  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum gratissimum  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Ocimum spp. | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Tetradenia riparia  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Labiatae | Trichostema lanceolatum | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Cinnamomum parthenoxylum | Ref. |
| Plantae | Lauraceae | Litsea ceylanica | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis x urophylla  | Ref. |
| Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus hystrix  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Lippia javanica  | Ref. |
| Plantae | Verbenaceae | Lippia multiflora  | Ref. |
| Plantae | Verbenaceae | Lippia ukambensis | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Elettaria cardamomum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Canabis sativa | Ref. |
| - | - | Citrus | Ref. |
| - | - | Eucalyptus | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|