| Name |
2-Methylanthraquinone Tectoquinone 2-Methylanthracene-9,10-dione |
| Formula |
C15H10O2 |
| Mw |
222.06807956 |
| CAS RN |
84-54-8 |
| C_ID |
C00002864
, 
|
| InChIKey |
NJWGQARXZDRHCD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O2/c1-9-6-7-12-13(8-9)15(17)11-5-3-2-4-10(11)14(12)16/h2-8H,1H3 |
| SMILES |
Cc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Newbouldia laevis  | Ref. |
| Plantae | Bignoniaceae | Tecomella undulata  | Ref. |
| Plantae | Euphorbiaceae | Acalypha indica  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia pulcherrima | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcas  | Ref. |
| Plantae | Iridaceae | Iris tectorum  | Ref. |
| Plantae | Labiatae | Tectona grandis  | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda lucida  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Psychotria serpens  | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia  | Ref. |
| Plantae | Rutaceae | Clausena heptaphylla | Ref. |
| Plantae | Verbenaceae | Lippia sidoides | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|