| Name |
1,4-Benzenediol Hydroquinone 4-Hydroxyphenol |
| Formula |
C6H6O2 |
| Mw |
110.03677944 |
| CAS RN |
123-31-9 |
| C_ID |
C00002656
, 
|
| InChIKey |
QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| SMILES |
Oc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Petroselinum spp. | Ref. |
| Plantae | Apiaceae | Pimpinella anisum  | Ref. |
| Plantae | Asteraceae | Xanthium canadense | Ref. |
| Plantae | Ericaceae | Arbutus unedo  | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Pinaceae | Pinus resinosa | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Podocarpaceae | Decussocarpus wallichianus | Ref. |
| Plantae | Primulaceae | Primula ovalifolia | Ref. |
| Plantae | Proteaceae | Protea mellifera  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Rutaceae | Murraya euchrestifolia | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| - | - | Dysidea cf.cristagalli | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Primula ovalifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|