| Name |
Orobol Norsantal Santol 5,7,3',4'-Tetrahydroxyisoflavone |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
480-23-9 |
| C_ID |
C00002554
, 
|
| InChIKey |
IOYHCQBYQJQBSK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| SMILES |
O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Anaxagorea luzonensis A.GRAY | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Bolusanthus specious | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lathyrus montanus  | Ref. |
| Plantae | Fabaceae | Lathyrus nissolia | Ref. |
| Plantae | Fabaceae | Lathyrus spp. | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
| Plantae | Moraceae | Maclura tinctoria  | Ref. |
| - | - | Stemphilium sp. No. 644 | Ref. |
|
|
zoom in
| Organism | Lathyrus nissolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Dement,Phytochem.,11,(1972),1089
Markham,Phytochem.,9,(1970),2359 |
|---|
|