| Name |
3beta-Benzoyloxytropane Benzoylpseudotropine Pseudotropine benzoate Tropacocain Tropacocaine |
| Formula |
C15H19NO2 |
| Mw |
245.14157886 |
| CAS RN |
537-26-8 |
| C_ID |
C00002305
, 
|
| InChIKey |
XQJMXPAEFMWDOZ-HHCNPLCINA-N |
| InChICode |
InChI=1S/C15H19NO2/c1-16-12-7-8-13(16)10-14(9-12)18-15(17)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+,14+ |
| SMILES |
CN1C2CC[C@@H]1C[C@H](OC(=O)c1ccccc1)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Elaeocarpaceae | Peripentadenia mearsii | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca Lam.var.coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum cuneatum (Wall.)Kurz | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum dekindtii (Engl.)O.E.Schultz | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ecarinatum Burck | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum macrocarpum O.E.schulz | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum mamacoca Mart. | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense (Morris) Hieron var.novogranatense | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum sideroxyloides Lam. | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum truxillense | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei o.E.Schulz | Ref. |
| - | - | Erythroxylon coca  | Ref. |
| - | - | Erythroxylon novogranatense | Ref. |
|
|
zoom in
| Organism | Erythroxylon coca | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|