| Name |
Inositol Myoinositol myo-Inositol |
| Formula |
C6H12O6 |
| Mw |
180.06338812 |
| CAS RN |
87-89-8 |
| C_ID |
C00001164
, 
|
| InChIKey |
CDAISMWEOUEBRE-VJCBHERCNA-N |
| InChICode |
InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3+,4+,5-,6- |
| SMILES |
OC1C(O)[C@H](O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Fungi | Incertae sedis | Phoma medicaginis | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Xylopia poilanei | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apocynaceae | Marsdenia tomentosa | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Fabaceae | Centrosema pubescens | Ref. |
| Plantae | Fabaceae | Dalbergia sissoo  | Ref. |
| Plantae | Fabaceae | Desmodium intortum | Ref. |
| Plantae | Fabaceae | Desmodium uncinatum | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lablab purpureus  | Ref. |
| Plantae | Fabaceae | Lens culinaris  | Ref. |
| Plantae | Fabaceae | Lotononis angolensis | Ref. |
| Plantae | Fabaceae | Lotononis bainesii | Ref. |
| Plantae | Fabaceae | Macroptilium atropurpureum | Ref. |
| Plantae | Fabaceae | Macroptilium bracteatum | Ref. |
| Plantae | Fabaceae | Macroptilium lathyroides | Ref. |
| Plantae | Fabaceae | Macrotyloma axillare | Ref. |
| Plantae | Fabaceae | Macrotyloma uniflorum | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pueraria phaseoloides  | Ref. |
| Plantae | Fabaceae | Rhynchosia beddomei | Ref. |
| Plantae | Fabaceae | Rhynchosia hirta  | Ref. |
| Plantae | Fabaceae | Stylosanthes guianensis | Ref. |
| Plantae | Fabaceae | Stylosanthes humilis | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Salicaceae | Populus maximowiczii | Ref. |
| Plantae | Salicaceae | Populus nigra  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum L.  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | Bergera koenegii | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|