| Name |
Phenylacetic acid alpha-Phenylacetate |
| Formula |
C8H8O2 |
| Mw |
136.0524295 |
| CAS RN |
103-82-2 |
| C_ID |
C00000750
, 
|
| InChIKey |
WLJVXDMOQOGPHL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| SMILES |
O=C(O)Cc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas pseudoalcaligenes | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces humidus S5-55 | Ref. |
| Fungi | Xylariaceae | Biscogniauxia mediterranea | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Fabaceae | Anthyllis subsimplex | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
|
|
zoom in
| Organism | Rehmannia glutinosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|